2-Heptanone, 3,5-dibromo-6-chloro-6-methyl
Modify Date: 2026-07-14 13:44:02
2-Heptanone, 3,5-dibromo-6-chloro-6-methyl structure
|
Common Name | 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl | ||
|---|---|---|---|---|
| CAS Number | 42483-44-3 | Molecular Weight | 320.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13Br2ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13Br2ClO |
|---|---|
| Molecular Weight | 320.45 |
| InChIKey | SNDGAHKDDDHIPG-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Br)CC(Br)C(C)(C)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl? |
| A: Molecular weight of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl is 320.45. |
| Q: What is the InChIKey of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl? |
| A: InChIKey of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl is SNDGAHKDDDHIPG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl? |
| A: Molecular formula of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl is C8H13Br2ClO. |
| Q: What is the SMILES notation of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl? |
| A: SMILES notation of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl is CC(=O)C(Br)CC(Br)C(C)(C)Cl. |
| Q: What is the CAS number of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl? |
| A: CAS number of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl is 42483-44-3. |
| Q: What is the English name of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl? |
| A: The English name of 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl is 2-Heptanone, 3,5-dibromo-6-chloro-6-methyl. |
| Q: What is the Chinese name of 42483-44-3? |
| A: Chinese name of 42483-44-3 is 42483-44-3. |