4-Heptanone,1,1,1,2,2,3,3-heptafluoro- structure
|
Common Name | 4-Heptanone,1,1,1,2,2,3,3-heptafluoro- | ||
|---|---|---|---|---|
| CAS Number | 425-22-9 | Molecular Weight | 240.11900 | |
| Density | 1.337g/cm3 | Boiling Point | 113ºC at 760mmHg | |
| Molecular Formula | C7H7F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 35.2ºC | |
| Name | 1,1,1,2,2,3,3-heptafluoroheptan-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 113ºC at 760mmHg |
| Molecular Formula | C7H7F7O |
| Molecular Weight | 240.11900 |
| Flash Point | 35.2ºC |
| Exact Mass | 240.03900 |
| PSA | 17.07000 |
| LogP | 3.18850 |
| Vapour Pressure | 21.2mmHg at 25°C |
| Index of Refraction | 1.319 |
| InChIKey | UFFMDNJCTCOCIX-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
4-Heptanone,1,1... CAS#:425-22-9 |
| Literature: McBee et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 917 |
|
~%
4-Heptanone,1,1... CAS#:425-22-9 |
| Literature: Dishart; Levine Journal of the American Chemical Society, 1956 , vol. 78, p. 2268 |
|
~%
4-Heptanone,1,1... CAS#:425-22-9 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1953 , vol. 75, p. 2059,2061 |
| Pentane,1,1,1,2,2,3,3,5,5,5-decafluoro-4-nitroso-4-(trifluoromethyl) |
| 1,1,1,2,2,3,3,5,5,5-decafluoro-4-nitroso-4-trifluoromethyl-pentane |
| 1,1,1,2,2,3,3,-Heptafluor-heptan-4-on |
| 1,1,1,3,3,4,4,5,5,5-Decafluoro-2-nitroso-2-(trifluoromethyl)pentane |
| Propyl-heptafluorpropyl-keton |
| 1,1,1,2,2,3,3,-heptafluoro-heptan-4-one |
| 1,1,1,2,2,3,3-heptafluoro-4-heptanone |