Heptafluorobutyric acid structure
|
Common Name | Heptafluorobutyric acid | ||
|---|---|---|---|---|
| CAS Number | 375-22-4 | Molecular Weight | 214.038 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 120.2±0.0 °C at 760 mmHg | |
| Molecular Formula | C4HF7O2 | Melting Point | -17.5 °C | |
| MSDS | Chinese USA | Flash Point | 18.0±25.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | perfluorobutyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 120.2±0.0 °C at 760 mmHg |
| Melting Point | -17.5 °C |
| Molecular Formula | C4HF7O2 |
| Molecular Weight | 214.038 |
| Flash Point | 18.0±25.9 °C |
| Exact Mass | 213.986481 |
| PSA | 37.30000 |
| LogP | 3.93 |
| Vapour density | 7 (vs air) |
| Vapour Pressure | 9.8±0.4 mmHg at 25°C |
| Index of Refraction | 1.291 |
| InChIKey | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)F |
| Water Solubility | miscible |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive |
| Risk Phrases | R35 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | ET4025000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2915900090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Glycation of human cortical and cancellous bone captures differences in the formation of Maillard reaction products between glucose and ribose.
PLoS ONE 10(2) , e0117240, (2015) To better understand some aspects of bone matrix glycation, we used an in vitro glycation approach. Within two weeks, our glycation procedures led to the formation of advanced glycation end products (... |
|
|
Spermine oxidase maintains basal skeletal muscle gene expression and fiber size and is strongly repressed by conditions that cause skeletal muscle atrophy.
Am. J. Physiol. Endocrinol. Metab. 308(2) , E144-58, (2015) Skeletal muscle atrophy is a common and debilitating condition that remains poorly understood at the molecular level. To better understand the mechanisms of muscle atrophy, we used mouse models to sea... |
|
|
Novel amphiphilic cationic porphyrin and its Ag(II) complex as potential anticancer agents.
J. Inorg. Biochem. 140 , 94-103, (2014) In the present study we have synthesized a novel amphiphilic porphyrin and its Ag(II) complex through modification of water-soluble porphyrinic structure in order to increase its lipophilicity and in ... |
|
Name: Percent plasma glucose concentration of drug treated mice (ob/ob) relative to vehicle...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL717777
|
| Perfluorobutanoic acid |
| MFCD00004171 |
| perfluorobutyric acid |
| 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| EINECS 206-786-3 |
| Heptafluorobutyric acid |
| Heptafluorobutanoic acid |