6-hydroxyflavanone structure
|
Common Name | 6-hydroxyflavanone | ||
|---|---|---|---|---|
| CAS Number | 4250-77-5 | Molecular Weight | 240.25400 | |
| Density | 1.288g/cm3 | Boiling Point | 464.3ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | 220-222 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | 6-hydroxyflavanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 464.3ºC at 760 mmHg |
| Melting Point | 220-222 °C (dec.)(lit.) |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 181.2ºC |
| Exact Mass | 240.07900 |
| PSA | 46.53000 |
| LogP | 3.09870 |
| Index of Refraction | 1.631 |
| InChIKey | XYHWPQUEOOBIOW-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)Oc2ccc(O)cc21 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-HYDROXYFLAVANONE |
| MFCD00017485 |
| 6-hydroxy-2-phenyl-2,3-dihydrochromen-4-one |