Benzo[g]pteridine-10 (2H)-acetaldehyde, 3,4-dihydro-7,8-dimethyl-2, 4-dioxo structure
|
Common Name | Benzo[g]pteridine-10 (2H)-acetaldehyde, 3,4-dihydro-7,8-dimethyl-2, 4-dioxo | ||
|---|---|---|---|---|
| CAS Number | 4250-90-2 | Molecular Weight | 284.27000 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)acetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.27000 |
| Exact Mass | 284.09100 |
| PSA | 97.71000 |
| LogP | 0.44870 |
| Index of Refraction | 1.728 |
| InChIKey | AUZWNAFEXXLJDA-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC=O)c2cc1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)acetaldehyde |
| 7,8-dimethyl-10-(formylmethyl)isoalloxazine |
| Benzo[g]pteridine-10(2H)-acetaldehyde,3,4-dihydro-7,8-dimethyl-2,4-dioxo |
| 6,7-Dimethyl-9-formylmethylisoalloxazine |
| Formylmethylflavine |
| 7,8-Dimethyl-10-formylmethylflavine-isoalloxazine |
| (7,8-Dimethyl-2,4-dioxo-3,4-dihydro-2H-benzo[g]pteridin-10-yl)-acetaldehyd |
| (7,8-dimethyl-2,4-dioxo-3,4-dihydro-2H-benzo[g]pteridin-10-yl)-acetaldehyde |
| 7,8-Dfmi |
| 2'-oxoethyl flavin |
| 10-(Formylmethyl)-7,8-dimethylisoalloxazine |