5,7-dihydroxy-6,8-diiodo-2-phenylchromen-4-one structure
|
Common Name | 5,7-dihydroxy-6,8-diiodo-2-phenylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 4252-99-7 | Molecular Weight | 506.03100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H8I2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,7-dihydroxy-6,8-diiodo-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H8I2O4 |
|---|---|
| Molecular Weight | 506.03100 |
| Exact Mass | 505.85100 |
| PSA | 70.67000 |
| LogP | 4.08040 |
| InChIKey | ATLALBZBFWDIPQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2c(I)c(O)c(I)c(O)c12 |
| HS Code | 2914700090 |
|---|
|
~72%
5,7-dihydroxy-6... CAS#:4252-99-7 |
| Literature: Park, Haeil; Tran, Thanh Dao; Hyun, Pyo Kim European Journal of Medicinal Chemistry, 2005 , vol. 40, # 9 p. 943 - 948 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5,7-Dihydroxy-6,8-dijod-2-phenyl-chromen-4-on |
| 5,7-Dihydroxy-6,8-dijod-flavon |
| 5,7-dihydroxy-6,8-diiodo-2-phenyl-chromen-4-one |
| 4H-1-Benzopyran-4-one,5,7-dihydroxy-6,8-diiodo-2-phenyl |