[2-(3,4-diacetyloxyphenyl)-2-oxoethyl] acetate structure
|
Common Name | [2-(3,4-diacetyloxyphenyl)-2-oxoethyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 42529-03-3 | Molecular Weight | 294.25700 | |
| Density | 1.264g/cm3 | Boiling Point | 437.1ºC at 760 mmHg | |
| Molecular Formula | C14H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.7ºC | |
| Name | [2-(3,4-diacetyloxyphenyl)-2-oxoethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 437.1ºC at 760 mmHg |
| Molecular Formula | C14H14O7 |
| Molecular Weight | 294.25700 |
| Flash Point | 194.7ºC |
| Exact Mass | 294.07400 |
| PSA | 95.97000 |
| LogP | 1.28300 |
| Index of Refraction | 1.513 |
| InChIKey | VDJDMWLIQCSQON-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)c1ccc(OC(C)=O)c(OC(C)=O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 255-871-1 |