1,2,4-Triacetoxybenzene structure
|
Common Name | 1,2,4-Triacetoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 613-03-6 | Molecular Weight | 252.22000 | |
| Density | 1.276g/cm3 | Boiling Point | 357ºC | |
| Molecular Formula | C12H12O6 | Melting Point | 98-100 °C(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Name | 1,2,4-Triacetoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 357ºC |
| Melting Point | 98-100 °C(lit.) |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22000 |
| Exact Mass | 252.06300 |
| PSA | 78.90000 |
| LogP | 1.46250 |
| Index of Refraction | 1.533 |
| InChIKey | AESFGSJWSUZRGW-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c(OC(C)=O)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DC4800000 |
| HS Code | 2915390090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
|
Synthesis of echinamines A and B, the first aminated hydroxynaphthazarins produced by the sea urchin Scaphechinus mirabilis and its analogues.
J. Nat. Prod. 69(8) , 1125-9, (2006) The first total synthesis of two marine aminated hydroxynaphthazarins, echinamines A (3-amino-7-ethyl-2,5,6,8-tetrahydroxy-1,4-naphthoquinone) and B (2-amino-7-ethyl-3,5,6,8-tetrahydroxy-1,4-naphthoqu... |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00008700 |
| EINECS 210-327-2 |
| (3,4-diacetyloxyphenyl) acetate |