4-hydroxypyridine structure
|
Common Name | 4-hydroxypyridine | ||
|---|---|---|---|---|
| CAS Number | 426-64-2 | Molecular Weight | 95.09930 | |
| Density | N/A | Boiling Point | 230-235ºC12 mm Hg(lit.) | |
| Molecular Formula | C5H5NO | Melting Point | 150-151ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxypyridine |
|---|
| Boiling Point | 230-235ºC12 mm Hg(lit.) |
|---|---|
| Melting Point | 150-151ºC(lit.) |
| Molecular Formula | C5H5NO |
| Molecular Weight | 95.09930 |
| Exact Mass | 95.03710 |
| PSA | 33.12000 |
| LogP | 0.78720 |
| InChIKey | AVVCGEANSDZGAS-UHFFFAOYSA-N |
| SMILES | O=C(OCCCCCCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| RTECS | UU7701450 |
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |