4-hydroxypyridine
4-hydroxypyridine structure
|
Common Name | 4-hydroxypyridine | ||
|---|---|---|---|---|
| CAS Number | 426-64-2 | Molecular Weight | 95.09930 | |
| Density | N/A | Boiling Point | 230-235ºC12 mm Hg(lit.) | |
| Molecular Formula | C5H5NO | Melting Point | 150-151ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-hydroxypyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 230-235ºC12 mm Hg(lit.) |
|---|---|
| Melting Point | 150-151ºC(lit.) |
| Molecular Formula | C5H5NO |
| Molecular Weight | 95.09930 |
| Exact Mass | 95.03710 |
| PSA | 33.12000 |
| LogP | 0.78720 |
| InChIKey | AVVCGEANSDZGAS-UHFFFAOYSA-N |
| SMILES | O=C(OCCCCCCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| RTECS | UU7701450 |
| HS Code | 2915900090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of 4-hydroxypyridine? |
| A: Melting point of 4-hydroxypyridine is 150-151ºC(lit.). |
| Q: What is the boiling point of 4-hydroxypyridine? |
| A: Boiling point of 4-hydroxypyridine is 230-235ºC12 mm Hg(lit.). |
| Q: What is the English name of 4-hydroxypyridine? |
| A: The English name of 4-hydroxypyridine is 4-hydroxypyridine. |
| Q: What is the molecular weight of 4-hydroxypyridine? |
| A: Molecular weight of 4-hydroxypyridine is 95.09930. |
| Q: What is the safety information for 4-hydroxypyridine? |
| A: Safety information for 4-hydroxypyridine: 26-36. |
| Q: What is the molecular formula of 4-hydroxypyridine? |
| A: Molecular formula of 4-hydroxypyridine is C5H5NO. |
| Q: What is the LogP of 4-hydroxypyridine? |
| A: LogP of 4-hydroxypyridine is 0.78720. |
| Q: What is the polar surface area (PSA) of 4-hydroxypyridine? |
| A: Polar surface area (PSA) of 4-hydroxypyridine is 33.12000. |
| Q: What is the InChIKey of 4-hydroxypyridine? |
| A: InChIKey of 4-hydroxypyridine is AVVCGEANSDZGAS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-hydroxypyridine? |
| A: SMILES notation of 4-hydroxypyridine is O=C(OCCCCCCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |