3-[(4-ethoxycarbonylphenyl)-formyl-amino]propanoic acid structure
|
Common Name | 3-[(4-ethoxycarbonylphenyl)-formyl-amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4261-01-2 | Molecular Weight | 265.26200 | |
| Density | 1.282g/cm3 | Boiling Point | 495.2ºC at 760 mmHg | |
| Molecular Formula | C13H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.3ºC | |
| Name | 3-(4-ethoxycarbonyl-N-formylanilino)propanoic acid |
|---|
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 495.2ºC at 760 mmHg |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26200 |
| Flash Point | 253.3ºC |
| Exact Mass | 265.09500 |
| PSA | 83.91000 |
| LogP | 1.93670 |
| Index of Refraction | 1.571 |
| InChIKey | XHBLKCDWXBAXCN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N(C=O)CCC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |