4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid
Modify Date: 2025-08-25 12:06:32
![4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid Structure](https://image.chemsrc.com/caspic/256/426268-06-6.png)
4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid structure
|
Common Name | 4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 426268-06-6 | Molecular Weight | 368.34500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[8-(2,1,3-benzoxadiazol-5-yl)-1,7-naphthyridin-6-yl]benzoic acid |
|---|
| Molecular Formula | C21H12N4O3 |
|---|---|
| Molecular Weight | 368.34500 |
| Exact Mass | 368.09100 |
| PSA | 102.00000 |
| LogP | 4.19820 |
| InChIKey | IALXIRPKVRUJQO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cc3cccnc3c(-c3ccc4nonc4c3)n2)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:14047-29-1![8-(benzo[c][1,2,5]oxadiazol-5-yl)-1,7-naphthyridin-6-yl trifluoromethanesulfonate Structure](https://image.chemsrc.com/caspic/239/426268-11-3.png)
CAS#:426268-11-3![Benzo[c][1,2,5]oxadiazol-5-ylboronic acid Structure](https://image.chemsrc.com/caspic/142/426268-09-9.png)
CAS#:426268-09-9![4-(8-Bromo-[1,7]naphthyridin-6-yl)-benzoic acid Structure](https://image.chemsrc.com/caspic/119/207279-31-0.png)
CAS#:207279-31-0![5-Bromobenzo[c][1,2,5]oxadiazole Structure](https://image.chemsrc.com/caspic/336/51376-06-8.png)
CAS#:51376-06-8
CAS#:875-51-4
CAS#:88-74-4![6-BROMOBENZO[C][1,2,5]OXADIAZOLE 1-OXIDE Structure](https://image.chemsrc.com/caspic/096/41153-83-7.png)
CAS#:41153-83-7
CAS#:5912-35-6
CAS#:5912-34-5|
Name: Induction of SQSTM1-dependent intracellular redistribution of GFP-tagged PDE4A4 asses...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL2161159
|
|
Name: Inhibition of human recombinant PDE4D
Source: ChEMBL
Target: 3',5'-cyclic-AMP phosphodiesterase 4D
External Id: CHEMBL5236673
|
|
Name: Inhibition of full-length PDE4A4 using cAMP as substrate by two-step radiochemical as...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL2161156
|
|
Name: Anti-inflammatory activity against ovalbumin induced lung inflammatory rat model asse...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL5236729
|
|
Name: Inhibition of human recombinant PDE4B
Source: ChEMBL
Target: 3',5'-cyclic-AMP phosphodiesterase 4B
External Id: CHEMBL5236725
|
|
Name: Anti-inflammatory activity in LPS-induced inflammatory mouse model assessed as reduct...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL5236728
|
|
Name: Anti-inflammatory activity against human PBMCs assessed as reduction in LPS-induced T...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5236727
|
Total 27, Current Page 1 of 3
1
2
3