3-nitroadamantane-1-carboxylic acid structure
|
Common Name | 3-nitroadamantane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 42711-76-2 | Molecular Weight | 225.24100 | |
| Density | 1.38g/cm3 | Boiling Point | 394ºC at 760 mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.2ºC | |
| Name | 3-nitroadamantane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760 mmHg |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24100 |
| Flash Point | 171.2ºC |
| Exact Mass | 225.10000 |
| PSA | 83.12000 |
| LogP | 2.20990 |
| Index of Refraction | 1.583 |
| InChIKey | VSRRAGQUKPLYMV-UHFFFAOYSA-N |
| SMILES | O=C(O)C12CC3CC(C1)CC([N+](=O)[O-])(C3)C2 |
|
~80%
3-nitroadamanta... CAS#:42711-76-2 |
| Literature: Daicel Chemical Industries, Ltd.; Ishii, Yasutaka Patent: EP897747 A1, 1999 ; |
|
~%
3-nitroadamanta... CAS#:42711-76-2 |
| Literature: Suzuki, Hitomi; Nonoyama, Nobuaki Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 20 p. 2965 - 2971 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Nitro-3-adamantanecarboxylic acid |
| 3-nitroadamantanecarboxylic acid |
| 3-Nitro-adamantan-1-carbonsaeure |
| 1-carboxy-3-nitroadamantane |
| 3-ADAMANTANECARBOXYLIC ACID,1-NITRO |