H-Gly-Pro-4MβNA structure
|
Common Name | H-Gly-Pro-4MβNA | ||
|---|---|---|---|---|
| CAS Number | 42761-76-2 | Molecular Weight | 327.37800 | |
| Density | 1.302g/cm3 | Boiling Point | 626.1ºC at 760mmHg | |
| Molecular Formula | C18H21N3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 332.4ºC | |
| Symbol |
GHS08 |
Signal Word | Warning | |
| Name | Gly-Pro 4-methoxy-β-naphthylamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 626.1ºC at 760mmHg |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.37800 |
| Flash Point | 332.4ºC |
| Exact Mass | 327.15800 |
| PSA | 84.66000 |
| LogP | 2.44780 |
| Index of Refraction | 1.661 |
| InChIKey | LSZPYDQEJZWJIJ-HNNXBMFYSA-N |
| SMILES | COc1cc(NC(=O)C2CCCN2C(=O)CN)cc2ccccc12 |
| Storage condition | −20°C |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351 |
| Precautionary Statements | P281 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 40 |
| Safety Phrases | 22-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| MFCD00037726 |
| 1-(2-aminoacetyl)-N-(4-methoxynaphthalen-2-yl)pyrrolidine-2-carboxamide |