2,2,4,4,6,6-hexakis(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene
Modify Date: 2025-08-24 19:06:12
2,2,4,4,6,6-hexakis(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene structure
|
Common Name | 2,2,4,4,6,6-hexakis(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene | ||
|---|---|---|---|---|
| CAS Number | 429-18-5 | Molecular Weight | 1029.18000 | |
| Density | 1.84g/cm3 | Boiling Point | 120ºC 2,5mm | |
| Molecular Formula | C18H12F30N3O6P3 | Melting Point | 14-16ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4,4,6,6-hexakis(2,2,3,3,3-pentafluoropropoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.84g/cm3 |
|---|---|
| Boiling Point | 120ºC 2,5mm |
| Melting Point | 14-16ºC |
| Molecular Formula | C18H12F30N3O6P3 |
| Molecular Weight | 1029.18000 |
| Exact Mass | 1028.95000 |
| PSA | 121.89000 |
| LogP | 11.43060 |
| Index of Refraction | 1.361 |
| InChIKey | UFNLQPBQHDVESI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)COP1(OCC(F)(F)C(F)(F)F)=NP(OCC(F)(F)C(F)(F)F)(OCC(F)(F)C(F)(F)F)=NP(OCC(F)(F)C(F)(F)F)(OCC(F)(F)C(F)(F)F)=N1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 20/21/22 |
| Safety Phrases | 23-36/37/39 |
|
~%
2,2,4,4,6,6-hex... CAS#:429-18-5 |
| Literature: Allcock,H.R.; Walsh,E.J. Journal of the American Chemical Society, 1972 , vol. 94, p. 119 - 124 |
|
~%
2,2,4,4,6,6-hex... CAS#:429-18-5 |
| Literature: Prons,V.N. et al. J. Gen. Chem. USSR (Engl. Transl.), 1977 , vol. 47, p. 1247 - 1251,1149 - 1153 |
|
~%
2,2,4,4,6,6-hex... CAS#:429-18-5 |
| Literature: Olin Mathieson Chem.Corp. Patent: US2876247 , 1957 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| pc0725 |