2-chloro-9-[3-(dimethylamino)propyl]thioxanthen-9-ol structure
|
Common Name | 2-chloro-9-[3-(dimethylamino)propyl]thioxanthen-9-ol | ||
|---|---|---|---|---|
| CAS Number | 4295-65-2 | Molecular Weight | 333.87600 | |
| Density | 1.249g/cm3 | Boiling Point | 472.1ºC at 760mmHg | |
| Molecular Formula | C18H20ClNOS | Melting Point | 148-151ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 239.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-chloro-9-[3-(dimethylamino)propyl]thioxanthen-9-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 472.1ºC at 760mmHg |
| Melting Point | 148-151ºC(lit.) |
| Molecular Formula | C18H20ClNOS |
| Molecular Weight | 333.87600 |
| Flash Point | 239.3ºC |
| Exact Mass | 333.09500 |
| PSA | 48.77000 |
| LogP | 4.38230 |
| Index of Refraction | 1.631 |
| InChIKey | YJINNJOMTOJZBH-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(O)c2ccccc2Sc2ccc(Cl)cc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: ULK1_INH_LUMI_1536_1X%INH PRUN
|
| 9-(3-Dimethylamino-propyl)-2-chlor-thioxanthenol-(9) |
| 2-Chlor-9-(3-dimethylaminopropyl)-9-thioxanthenol |
| EINECS 224-302-9 |
| 2-Chlor-10-(3-dimethylamino-propyl)-10-hydroxy-thioxanthen |
| MFCD03094044 |
| 2-Chlor-9-hydroxy-9-(3-dimethylamino-propyl)-thioxanthen |
| 2-Chloro-9-(3-(dimethylamino)propyl)-thioxanthen-9-ol |
| 2-Chlor-9-(3-dimethylamino-propyl)-thioxanthen-9-ol |