Benzenesulfonic acid, 4-(acetylamino)-, phenyl ester structure
|
Common Name | Benzenesulfonic acid, 4-(acetylamino)-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 43001-55-4 | Molecular Weight | 291.32200 | |
| Density | 1.347g/cm3 | Boiling Point | 521.9ºC at 760 mmHg | |
| Molecular Formula | C14H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.5ºC | |
| Name | phenyl 4-acetamidobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 521.9ºC at 760 mmHg |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.32200 |
| Flash Point | 269.5ºC |
| Exact Mass | 291.05700 |
| PSA | 80.85000 |
| LogP | 3.56650 |
| Index of Refraction | 1.61 |
| InChIKey | YTBSBFHQGLBQNI-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccccc2)cc1 |
|
~47%
Benzenesulfonic... CAS#:43001-55-4 |
| Literature: Bailey, Karl; Cowling, Rebecca; Tan, Eng Wui; Webb, Daniel Bioorganic and Medicinal Chemistry, 2004 , vol. 12, # 3 p. 595 - 601 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzenesulfonic acid,4-(acetylamino)-,phenyl ester |
| Phenyl-N-acetylsulfanilat |
| 4-phenoxysulfonylacetanilide |
| N-acetyl-sulfanilic acid phenyl ester |
| N-Acetyl-sulfanilsaeure-phenylester |
| p-Acetamino-benzolsulfonsaeure-phenylester |
| 4-(Acetylamino)benzenesulfonic acid,phenyl ester |