Bz-L-Trp-OH structure
|
Common Name | Bz-L-Trp-OH | ||
|---|---|---|---|---|
| CAS Number | 4302-66-3 | Molecular Weight | 308.33100 | |
| Density | 1.335g/cm3 | Boiling Point | 647.8ºC at 760 mmHg | |
| Molecular Formula | C18H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.6ºC | |
| Name | (2S)-2-benzamido-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 647.8ºC at 760 mmHg |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.33100 |
| Flash Point | 345.6ºC |
| Exact Mass | 308.11600 |
| PSA | 82.19000 |
| LogP | 2.98450 |
| Index of Refraction | 1.681 |
| InChIKey | WPBCXLCJWLNDPV-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)O)c1ccccc1 |
| Storage condition | Store at RT. |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bz-L-tryptophan |
| N-benzoyl-D,L-tryptophane |
| Benzoyl-L-tryptophan |
| L-Tryptophan,N-benzoyl |
| AmbotzBAA0047 |
| N-Benzoyl-L-Tryptophan |
| N-benzoyl-L-tryptophane |