4-(tert-Butyl)benzohydrazide structure
|
Common Name | 4-(tert-Butyl)benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 43100-38-5 | Molecular Weight | 192.258 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O | Melting Point | 120-127 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-tert-Butylbenzhydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Melting Point | 120-127 °C(lit.) |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.258 |
| Exact Mass | 192.126266 |
| PSA | 55.12000 |
| LogP | 1.93 |
| Index of Refraction | 1.535 |
| InChIKey | XYUFQWDLRLHUPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)NN)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2928000090 |
|
~89%
4-(tert-Butyl)b... CAS#:43100-38-5 |
| Literature: Murty; Ram, Kesur R.; Rao, Rayudu Venkateswara; Yadav; Rao, Janapala Venkateswara; Pamanji; Velatooru Letters in Drug Design and Discovery, 2012 , vol. 9, # 3 p. 276 - 281 |
|
~99%
4-(tert-Butyl)b... CAS#:43100-38-5 |
| Literature: Li, Zhen; Chen, Weirong; Hale, Jeffrey J.; Lynch, Christopher L.; Mills, Sander G.; Hajdu, Richard; Keohane, Carol Ann; Rosenbach, Mark J.; Milligan, James A.; Shei, Gan-Ju; Chrebet, Gary; Parent, Stephen A.; Bergstrom, James; Card, Deborah; Forrest, Michael; Quackenbush, Elizabeth J.; Wickham, L. Alexandra; Vargas, Hugo; Evans, Rose M.; Rosen, Hugh; Mandala, Suzanne Journal of Medicinal Chemistry, 2005 , vol. 48, # 20 p. 6169 - 6173 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Zn2+ selective luminescent 'off-on'probes derived from diaryl oxadiazole and aza-15-crown-5. Mashraqui SH, et al.
Tetrahedron 63(45) , 11093-11100, (2007)
|
| 4-(tert-butyl)benzene-1-carbohydrazide |
| Benzoic acid, 4-(1,1-dimethylethyl)-, hydrazide |
| 4-tert-Butylbenzoic hydrazide |
| 4-TERT-BUTYLBENZHYDRAZIDE |
| 4-(2-Methyl-2-propanyl)benzohydrazide |
| EINECS 256-090-9 |
| 4-tert-butylbenzohydrazide |
| 4-tert-Butylbenzoylhydrazine |
| 4-(tert-Butyl)benzohydrazide |
| MFCD00014763 |