N-ethenyl-2,2,3,3,4,4,4-heptafluoro-butanamide structure
|
Common Name | N-ethenyl-2,2,3,3,4,4,4-heptafluoro-butanamide | ||
|---|---|---|---|---|
| CAS Number | 4314-32-3 | Molecular Weight | 239.09100 | |
| Density | 1.432g/cm3 | Boiling Point | 161.8ºC at 760 mmHg | |
| Molecular Formula | C6H4F7NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 51.6ºC | |
| Name | N-ethenyl-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 161.8ºC at 760 mmHg |
| Molecular Formula | C6H4F7NO |
| Molecular Weight | 239.09100 |
| Flash Point | 51.6ºC |
| Exact Mass | 239.01800 |
| PSA | 29.10000 |
| LogP | 2.46990 |
| Index of Refraction | 1.332 |
| InChIKey | MFRIGKIFAFQPOK-UHFFFAOYSA-N |
| SMILES | C=CNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2,3,3,4,4-Heptafluor-N-vinyl-buttersaeureamid |