N-Methyl-N-trimethylsilylheptafluorobutyramide structure
|
Common Name | N-Methyl-N-trimethylsilylheptafluorobutyramide | ||
|---|---|---|---|---|
| CAS Number | 53296-64-3 | Molecular Weight | 299.261 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 148.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H12F7NOSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 50.1±27.3 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-trimethylsilylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 148.0±0.0 °C at 760 mmHg |
| Molecular Formula | C8H12F7NOSi |
| Molecular Weight | 299.261 |
| Flash Point | 50.1±27.3 °C |
| Exact Mass | 299.057648 |
| PSA | 20.31000 |
| LogP | 4.79 |
| Vapour Pressure | 4.3±0.2 mmHg at 25°C |
| Index of Refraction | 1.359 |
| InChIKey | CMXKINNDZCNCEI-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C(F)(F)C(F)(F)C(F)(F)F)[Si](C)(C)C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
|
Detection of virgin coconut oil adulteration with animal fats using quantitative cholesterol by GC × GC-TOF/MS analysis.
Food Chem. 178 , 128-35, (2015) A new method based on the cholesterol level was developed to detect the presence of animal fats in virgin coconut oil (VCO). In this study, the sterols in VCO and animal fats was separated using conve... |
|
|
M. Donike
J. Chromatogr. A. 115 , 591, (1975)
|
|
|
J. Heberle, G. Simchen
Silylating Agents, 2nd ed. Buchs , (1995)
|
| Butanamide, 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-(trimethylsilyl)- |
| N-Trimethylsilyl-N-methylheptafluorobutyramide,MSHFBA |
| PC9236 |
| 2,2,3,3,4,4,4-Heptafluoro-N-methyl-N-(trimethylsilyl)butanamide |
| N-Methyl-N-trimethylsilylheptafluorobutyramide |
| MFCD00077822 |
| MSHFBA |