1-Iodo-2-(heptafluoroisopropyl)cyclohexane structure
|
Common Name | 1-Iodo-2-(heptafluoroisopropyl)cyclohexane | ||
|---|---|---|---|---|
| CAS Number | 4316-00-1 | Molecular Weight | 378.06900 | |
| Density | 1.78 | Boiling Point | 76-80/8mm | |
| Molecular Formula | C9H10F7I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.6ºC | |
| Name | 1-Iodo-2-(heptafluoroisopropyl)cyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.78 |
|---|---|
| Boiling Point | 76-80/8mm |
| Molecular Formula | C9H10F7I |
| Molecular Weight | 378.06900 |
| Flash Point | 89.6ºC |
| Exact Mass | 377.97200 |
| LogP | 4.81310 |
| Index of Refraction | 1.432 |
| InChIKey | MPDWEHWICQEPCD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(C1CCCCC1I)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903890090 |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodocyclohexane |