Filastatin structure
|
Common Name | Filastatin | ||
|---|---|---|---|---|
| CAS Number | 431996-53-1 | Molecular Weight | 359.80700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18ClN3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of FilastatinFilastatin is a long-lasting inhibitor of Candida albicans filamentation. Filastatin inhibits adhesion by multiple pathogenic Candida species with an IC50 of ~3 μM in the GFP-based adhesion assay. Filastatin inhibits fungal adhesion to polystyrene and human cells, the yeast-to-hyphal morphological transition, induction of the hyphal-specific HWP1 promoter. Filastatin has potent antifungal effect[1]. |
| Name | (3-chloro-4-methylphenyl)(4-(4-nitrophenyl)piperazin-1-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Description | Filastatin is a long-lasting inhibitor of Candida albicans filamentation. Filastatin inhibits adhesion by multiple pathogenic Candida species with an IC50 of ~3 μM in the GFP-based adhesion assay. Filastatin inhibits fungal adhesion to polystyrene and human cells, the yeast-to-hyphal morphological transition, induction of the hyphal-specific HWP1 promoter. Filastatin has potent antifungal effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H18ClN3O3 |
|---|---|
| Molecular Weight | 359.80700 |
| Exact Mass | 359.10400 |
| PSA | 69.37000 |
| LogP | 4.04510 |
| InChIKey | PNECWWUOUHGWQG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1Cl |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H410 |
| Precautionary Statements | P261-P273-P305 + P351 + P338-P501 |
| Hazard Codes | Xi |
| RIDADR | UN 3077 9 / PGIII |
| Filastatin |