SMI481 structure
|
Common Name | SMI481 | ||
|---|---|---|---|---|
| CAS Number | 432020-20-7 | Molecular Weight | 363.771 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 543.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H15ClFN3O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 282.4±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of SMI481NPPM 6748-481 is a selective inhibitor of the yeast phosphatidylinositol transfer protein (PITP) Sec14[1]. |
| Name | (4-Chloro-3-nitrophenyl)[4-(2-fluorophenyl)-1-piperazinyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Description | NPPM 6748-481 is a selective inhibitor of the yeast phosphatidylinositol transfer protein (PITP) Sec14[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.3±50.0 °C at 760 mmHg |
| Molecular Formula | C17H15ClFN3O3 |
| Molecular Weight | 363.771 |
| Flash Point | 282.4±30.1 °C |
| Exact Mass | 363.078583 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | LSPJXCGEFJDMHA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCN(c2ccccc2F)CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| (4-Chloro-3-nitrophenyl)[4-(2-fluorophenyl)-1-piperazinyl]methanone |
| Methanone, (4-chloro-3-nitrophenyl)[4-(2-fluorophenyl)-1-piperazinyl]- |
| MFCD03575351 |