tert-Butyl chloromethyl succinate structure
|
Common Name | tert-Butyl chloromethyl succinate | ||
|---|---|---|---|---|
| CAS Number | 432037-43-9 | Molecular Weight | 222.666 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 254.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C9H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.3±19.4 °C | |
| Name | 4-O-tert-butyl 1-O-(chloromethyl) butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 254.8±15.0 °C at 760 mmHg |
| Molecular Formula | C9H15ClO4 |
| Molecular Weight | 222.666 |
| Flash Point | 93.3±19.4 °C |
| Exact Mass | 222.065887 |
| PSA | 52.60000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | ZEHMWPBRDVLBMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCC(=O)OCCl |
| HS Code | 2917190090 |
|---|
|
~%
tert-Butyl chlo... CAS#:432037-43-9 |
| Literature: WO2004/89925 A1, ; Page 86-88 ; WO 2004/089925 A1 |
|
~%
tert-Butyl chlo... CAS#:432037-43-9 |
| Literature: US2002/165201 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| FD7113 |
| BUT019 |
| Butanedioic acid, chloromethyl 1,1-dimethylethyl ester |
| FC0593 |
| chloromethyl-t-butylsuccinate |
| chloromethyl tert-butyl succinate |
| tert-Butyl chloromethyl succinate |
| Chloromethyl 2-methyl-2-propanyl succinate |