phenylthiohydantoin-norleucine
phenylthiohydantoin-norleucine structure
|
Common Name | phenylthiohydantoin-norleucine | ||
|---|---|---|---|---|
| CAS Number | 4333-22-6 | Molecular Weight | 248.34400 | |
| Density | 1.22g/cm3 | Boiling Point | 343.9ºC at 760 mmHg | |
| Molecular Formula | C13H16N2OS | Melting Point | 136ºC | |
| MSDS | N/A | Flash Point | 161.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | phenylthiohydantoin-norleucine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 343.9ºC at 760 mmHg |
| Melting Point | 136ºC |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.34400 |
| Flash Point | 161.8ºC |
| Exact Mass | 248.09800 |
| PSA | 64.43000 |
| LogP | 2.86030 |
| Index of Refraction | 1.624 |
| InChIKey | FJQCWUDEVCYMRZ-UHFFFAOYSA-N |
| SMILES | CCCCC1NC(=S)N(c2ccccc2)C1=O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| PTH-DL-NORLEUCINE |
| 5-Butyl-3-phenyl-2-thiohydantoin |
| 2-Thioxo-3-phenyl-5-butylimidazolidine-4-one |
| 5-Butyl-3-phenyl-2-thiohydantoinPTH-norleucine |
| PTH-DL-Norleucine Phenylthiohydantoin-DL-norleucine |
| 5-Butyl-3-phenyl-2-thioxo-4-imidazolidinone |
| PHENYLTHIOHYDANTOIN-DL-NORLEUCINE |
| PTH-norleucine |
| 5-BUTYL-3-PHENYL-2-THIOHYDANTOIN |
| 5-butyl-3-phenyl-2-thioxo-imidazolidin-4-one |
| PTH-NORLEUCINE |
| 5-Butyl-3-phenyl-thiohydantoin |
| PTH-DL-NORLEUCINE STANDARD |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of phenylthiohydantoin-norleucine? |
| A: Boiling point of phenylthiohydantoin-norleucine is 343.9ºC at 760 mmHg. |
| Q: What is the CAS number of phenylthiohydantoin-norleucine? |
| A: CAS number of phenylthiohydantoin-norleucine is 4333-22-6. |
| Q: What is the molecular formula of phenylthiohydantoin-norleucine? |
| A: Molecular formula of phenylthiohydantoin-norleucine is C13H16N2OS. |
| Q: What is the LogP of phenylthiohydantoin-norleucine? |
| A: LogP of phenylthiohydantoin-norleucine is 2.86030. |
| Q: What is the polar surface area (PSA) of phenylthiohydantoin-norleucine? |
| A: Polar surface area (PSA) of phenylthiohydantoin-norleucine is 64.43000. |
| Q: What is the InChIKey of phenylthiohydantoin-norleucine? |
| A: InChIKey of phenylthiohydantoin-norleucine is FJQCWUDEVCYMRZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of phenylthiohydantoin-norleucine? |
| A: SMILES notation of phenylthiohydantoin-norleucine is CCCCC1NC(=S)N(c2ccccc2)C1=O. |
| Q: What is the English name of phenylthiohydantoin-norleucine? |
| A: The English name of phenylthiohydantoin-norleucine is phenylthiohydantoin-norleucine. |
| Q: What is the melting point of phenylthiohydantoin-norleucine? |
| A: Melting point of phenylthiohydantoin-norleucine is 136ºC. |
| Q: What is the molecular weight of phenylthiohydantoin-norleucine? |
| A: Molecular weight of phenylthiohydantoin-norleucine is 248.34400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |