L-Ascorbyl 2,6-Dibutyrate structure
|
Common Name | L-Ascorbyl 2,6-Dibutyrate | ||
|---|---|---|---|---|
| CAS Number | 4337-04-6 | Molecular Weight | 316.304 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 419.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O8 | Melting Point | 122ºC | |
| MSDS | N/A | Flash Point | 148.8±22.2 °C | |
Use of L-Ascorbyl 2,6-DibutyrateL-Ascorbyl 2,6-Dibutyrate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | [(2S)-2-[(2R)-4-butanoyloxy-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] butanoate |
|---|---|
| Synonym | More Synonyms |
| Description | L-Ascorbyl 2,6-Dibutyrate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.4±45.0 °C at 760 mmHg |
| Melting Point | 122ºC |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.304 |
| Flash Point | 148.8±22.2 °C |
| Exact Mass | 316.115814 |
| PSA | 119.36000 |
| LogP | 1.22 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | BFXWCTCPRAYDEB-PRHODGIISA-N |
| SMILES | CCCC(=O)OCC(O)C1OC(=O)C(OC(=O)CCC)=C1O |
| HS Code | 2932209090 |
|---|
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (5R)-5-[(1R)-2-(Butyryloxy)-1-hydroxyethyl]-4-hydroxy-2-oxo-2,5-dihydro-3-furanyl butyrate |
| 2,6-O-Di-n-butyryl-ascorbinsaeure |
| 2,6-Di-O-butyryl-L-ascorbic Acid |
| (5R)-5-[(1S)-2-(Butyryloxy)-1-hydroxyethyl]-4-hydroxy-2-oxo-2,5-dihydro-3-furanyl butyrate |
| L-Ascorbyl 2,6-Dibutyrate |
| (5R)-5-[(1S)-2-(Butyryloxy)-1-hydroxyethyl]-4-hydroxy-2-oxo-2,5-dihydrofuran-3-yl butyrate (non-preferred name) |
| 2,6-O-Dibutyryl-ascorbinsaeure |