10H-1,2,4-Triazolo[4,3:2,3][1,2,4]triazino[5,6-b]indole, 3,10-dimethyl structure
|
Common Name | 10H-1,2,4-Triazolo[4,3:2,3][1,2,4]triazino[5,6-b]indole, 3,10-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 4349-84-2 | Molecular Weight | 238.24800 | |
| Density | 1.58g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,10-dimethyl-1,2,4-triazolo[4',3':2,3]1,2,4-triazino[5,6-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.24800 |
| Exact Mass | 238.09700 |
| PSA | 60.90000 |
| LogP | 1.47260 |
| Index of Refraction | 1.853 |
| InChIKey | UXHOLPARXQTOFH-UHFFFAOYSA-N |
| SMILES | Cc1nnc2nc3c(nn12)c1ccccc1n3C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,10-dimethyl-10H-[1,2,4]triazolo[4',3':2,3][1,2,4]triazino[5,6-b]indole |
| 3,10-dimethyl-1,2,4-triazolo[4,3-b]1,2,4-triazino[5,6-b]indole |
| 10H-1,2,4-Triazolo(4',3':2,3)(1,2,4)triazino(5,6-b)indole,3,10-dimethyl |