2-Chloro-6-ethylquinoline-3-carboxaldehyde
Modify Date: 2025-08-26 22:09:47
2-Chloro-6-ethylquinoline-3-carboxaldehyde structure
|
Common Name | 2-Chloro-6-ethylquinoline-3-carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 436088-07-2 | Molecular Weight | 219.66700 | |
| Density | 1.268g/cm3 | Boiling Point | 360.3ºC at 760 mmHg | |
| Molecular Formula | C12H10ClNO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 171.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-chloro-6-ethylquinoline-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 360.3ºC at 760 mmHg |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.66700 |
| Flash Point | 171.7ºC |
| Exact Mass | 219.04500 |
| PSA | 29.96000 |
| LogP | 3.26310 |
| Index of Refraction | 1.652 |
| InChIKey | LZEZPJQSBFVYGR-UHFFFAOYSA-N |
| SMILES | CCc1ccc2nc(Cl)c(C=O)cc2c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| 2-Chloro-6-ethylquinoline-3-carboxaldehyde |