N-[(4-methoxyphenyl)methyl]-1-(4-propan-2-ylphenyl)methanamine structure
|
Common Name | N-[(4-methoxyphenyl)methyl]-1-(4-propan-2-ylphenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 436088-69-6 | Molecular Weight | 269.38100 | |
| Density | N/A | Boiling Point | 383.4ºC at 760 mmHg | |
| Molecular Formula | C18H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.1ºC | |
| Name | N-[(4-methoxyphenyl)methyl]-1-(4-propan-2-ylphenyl)methanamine |
|---|
| Boiling Point | 383.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.38100 |
| Flash Point | 165.1ºC |
| Exact Mass | 269.17800 |
| PSA | 21.26000 |
| LogP | 4.49930 |
| InChIKey | QOJMGCQDWVYSMV-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNCc2ccc(C(C)C)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |