N-(4-amino-2-methoxyphenyl)-4-chlorobenzamide structure
|
Common Name | N-(4-amino-2-methoxyphenyl)-4-chlorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 436089-17-7 | Molecular Weight | 276.71800 | |
| Density | 1.339g/cm3 | Boiling Point | 387.1ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9ºC | |
| Name | N-(4-amino-2-methoxyphenyl)-4-chlorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 387.1ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.71800 |
| Flash Point | 187.9ºC |
| Exact Mass | 276.06700 |
| PSA | 64.35000 |
| LogP | 3.83730 |
| Index of Refraction | 1.664 |
| InChIKey | ACAYKXVXHCSWSH-UHFFFAOYSA-N |
| SMILES | COc1cc(N)ccc1NC(=O)c1ccc(Cl)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-Amino-2-methoxy-phenyl)-4-chloro-benzamide |
| N-(4-amino-2-methoxyphenyl)(4-chlorophenyl)carboxamide |