4-Ethyl-5-(5-phenyl-tetrazol-2-ylmethyl)-4H-[1,2,4]triazole-3-thiol structure
|
Common Name | 4-Ethyl-5-(5-phenyl-tetrazol-2-ylmethyl)-4H-[1,2,4]triazole-3-thiol | ||
|---|---|---|---|---|
| CAS Number | 436092-66-9 | Molecular Weight | 287.34400 | |
| Density | 1.48g/cm3 | Boiling Point | 452.1ºC at 760 mmHg | |
| Molecular Formula | C12H13N7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.2ºC | |
| Name | 4-Ethyl-5-(5-phenyl-tetrazol-2-ylmethyl)-4H-[1,2,4]triazole-3-thiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 452.1ºC at 760 mmHg |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.34400 |
| Flash Point | 227.2ºC |
| Exact Mass | 287.09500 |
| PSA | 113.11000 |
| LogP | 1.28850 |
| Index of Refraction | 1.772 |
| InChIKey | JMBQRZWXQXCCGV-UHFFFAOYSA-N |
| SMILES | CCn1c(Cn2nnc(-c3ccccc3)n2)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-ethyl-3-[(5-phenyltetrazol-2-yl)methyl]-1H-1,2,4-triazole-5-thione |