2-(2-methylpropyl)-2-phenethyl-propanedioic acid structure
|
Common Name | 2-(2-methylpropyl)-2-phenethyl-propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4361-10-8 | Molecular Weight | 264.31700 | |
| Density | 1.161g/cm3 | Boiling Point | 422.3ºC at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | 2-(2-methylpropyl)-2-(2-phenylethyl)propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 422.3ºC at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 223.3ºC |
| Exact Mass | 264.13600 |
| PSA | 74.60000 |
| LogP | 2.82090 |
| Index of Refraction | 1.539 |
| InChIKey | KSRCWCBLXGHIBB-UHFFFAOYSA-N |
| SMILES | CC(C)CC(CCc1ccccc1)(C(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
2-(2-methylprop... CAS#:4361-10-8 |
| Literature: Blicke; Centolella Journal of the American Chemical Society, 1938 , vol. 60, p. 2923 |
|
~%
2-(2-methylprop... CAS#:4361-10-8 |
| Literature: Blicke; Centolella Journal of the American Chemical Society, 1938 , vol. 60, p. 2923 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Isobutyl-phenaethyl-malonsaeure |
| iso-Butyl-p-chlorbenzoat |
| 4-Chlorobenzoic acid,2-methylpropyl ester |
| isobutyl-phenethyl-malonic acid |
| Isobutyl 4-chlorobenzoate |