diethyl 2-(phenylethyl)malonoate structure
|
Common Name | diethyl 2-(phenylethyl)malonoate | ||
|---|---|---|---|---|
| CAS Number | 6628-68-8 | Molecular Weight | 264.31700 | |
| Density | 1.078 g/cm3 | Boiling Point | 356.4ºC at 760 mmHg ,112-114ºC 0,2mm | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | diethyl 2-(2-phenylethyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.078 g/cm3 |
|---|---|
| Boiling Point | 356.4ºC at 760 mmHg ,112-114ºC 0,2mm |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 171.3ºC |
| Exact Mass | 264.13600 |
| PSA | 52.60000 |
| LogP | 2.36160 |
| Index of Refraction | 1.495 |
| InChIKey | LMFLGETWXFOVMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)C(=O)OCC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2917190090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Diethyl 2-phenylethylmalonate |
| Diethyl ester of 2-Phenethylmalonic acid |
| EINECS 229-610-7 |
| MFCD00026887 |
| diethyl phenethylmalonate |
| 2-phenethylmalonic acid diethyl ester |