2-benzyl-3-phenyl-prop-2-enoic acid structure
|
Common Name | 2-benzyl-3-phenyl-prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 4361-83-5 | Molecular Weight | 238.28100 | |
| Density | 1.179g/cm3 | Boiling Point | 406ºC at 760 mmHg | |
| Molecular Formula | C16H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302ºC | |
| Name | 2-benzyl-3-phenylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 406ºC at 760 mmHg |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28100 |
| Flash Point | 302ºC |
| Exact Mass | 238.09900 |
| PSA | 37.30000 |
| LogP | 3.39730 |
| Index of Refraction | 1.638 |
| InChIKey | KNEFRHCUYCDKRK-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=Cc1ccccc1)Cc1ccccc1 |
|
~%
2-benzyl-3-phen... CAS#:4361-83-5 |
| Literature: Oglialoro Gazzetta Chimica Italiana, 1890 , vol. 20, p. 163 |
|
~%
2-benzyl-3-phen... CAS#:4361-83-5 |
| Literature: Moriconi,E.J.; Kelly,J.F. Journal of Organic Chemistry, 1968 , vol. 33, # 8 p. 3036 - 3046 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-benzyl-3-phenylacrylic acid |
| 2-Benzyl-3-phenyl-acrylsaeure |