2-Benzyl-3-phenylpropanoic acid
2-Benzyl-3-phenylpropanoic acid structure
|
Common Name | 2-Benzyl-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 618-68-8 | Molecular Weight | 240.297 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 373.8±11.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.7±14.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-benzyl-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.8±11.0 °C at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.297 |
| Flash Point | 270.7±14.4 °C |
| Exact Mass | 240.115036 |
| PSA | 37.30000 |
| LogP | 3.73 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | RBLAOGBEJPHFHW-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1ccccc1)Cc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dibenzylacetic acid |
| 2-Benzyl-3-phenylpropanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-benzyl-3-phenylpropanoic acid have? |
| A: English synonyms of 2-benzyl-3-phenylpropanoic acid: Dibenzylacetic acid, 2-Benzyl-3-phenylpropanoic acid. |
| Q: What is the polar surface area (PSA) of 2-benzyl-3-phenylpropanoic acid? |
| A: Polar surface area (PSA) of 2-benzyl-3-phenylpropanoic acid is 37.30000. |
| Q: What is the English name of 2-benzyl-3-phenylpropanoic acid? |
| A: The English name of 2-benzyl-3-phenylpropanoic acid is 2-benzyl-3-phenylpropanoic acid. |
| Q: What is the InChIKey of 2-benzyl-3-phenylpropanoic acid? |
| A: InChIKey of 2-benzyl-3-phenylpropanoic acid is RBLAOGBEJPHFHW-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2-benzyl-3-phenylpropanoic acid? |
| A: Boiling point of 2-benzyl-3-phenylpropanoic acid is 373.8±11.0 °C at 760 mmHg. |
| Q: What is the molecular formula of 2-benzyl-3-phenylpropanoic acid? |
| A: Molecular formula of 2-benzyl-3-phenylpropanoic acid is C16H16O2. |
| Q: What is the CAS number of 2-benzyl-3-phenylpropanoic acid? |
| A: CAS number of 2-benzyl-3-phenylpropanoic acid is 618-68-8. |
| Q: What is the SMILES notation of 2-benzyl-3-phenylpropanoic acid? |
| A: SMILES notation of 2-benzyl-3-phenylpropanoic acid is O=C(O)C(Cc1ccccc1)Cc1ccccc1. |
| Q: What is the molecular weight of 2-benzyl-3-phenylpropanoic acid? |
| A: Molecular weight of 2-benzyl-3-phenylpropanoic acid is 240.297. |
| Q: What is the LogP of 2-benzyl-3-phenylpropanoic acid? |
| A: LogP of 2-benzyl-3-phenylpropanoic acid is 3.73. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |