2-Benzyl-3-phenylpropanoic acid structure
|
Common Name | 2-Benzyl-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 618-68-8 | Molecular Weight | 240.297 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 373.8±11.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.7±14.4 °C | |
| Name | 2-benzyl-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.8±11.0 °C at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.297 |
| Flash Point | 270.7±14.4 °C |
| Exact Mass | 240.115036 |
| PSA | 37.30000 |
| LogP | 3.73 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | RBLAOGBEJPHFHW-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1ccccc1)Cc1ccccc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
| Dibenzylacetic acid |
| 2-Benzyl-3-phenylpropanoic acid |