4-propan-2-ylbenzenesulfonyl fluoride structure
|
Common Name | 4-propan-2-ylbenzenesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 4365-11-1 | Molecular Weight | 202.24600 | |
| Density | 1.188g/cm3 | Boiling Point | 242.81ºC at 760 mmHg | |
| Molecular Formula | C9H11FO2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 100.648ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-propan-2-ylbenzenesulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 242.81ºC at 760 mmHg |
| Molecular Formula | C9H11FO2S |
| Molecular Weight | 202.24600 |
| Flash Point | 100.648ºC |
| Exact Mass | 202.04600 |
| PSA | 42.52000 |
| LogP | 3.54900 |
| Index of Refraction | 1.494 |
| InChIKey | OAEGHLYWVJNQGT-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(S(=O)(=O)F)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
| RIDADR | UN 3265 8 / PGII |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| p-cumenesulfonyl fluoride |