triphenylcarbenium hexafluorophosphate structure
|
Common Name | triphenylcarbenium hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 437-17-2 | Molecular Weight | 388.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15F6P | Melting Point | 150ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diphenylmethylbenzene,hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 150ºC |
|---|---|
| Molecular Formula | C19H15F6P |
| Molecular Weight | 388.28700 |
| Exact Mass | 388.08200 |
| PSA | 13.59000 |
| LogP | 8.08820 |
| InChIKey | IBTFOFOFRZKIJU-UHFFFAOYSA-N |
| SMILES | F[P-](F)(F)(F)(F)F.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | Soluble in water. (27 g/L) at 25°C. |
| Hazard Codes | C:Corrosive; |
|---|---|
| Risk Phrases | R20/21;R34 |
| Safety Phrases | S28 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
|
~%
triphenylcarben... CAS#:437-17-2 |
| Literature: Plack, Volker; Goerlich, Jens R.; Schmutzler, Reinhard Journal of Fluorine Chemistry, 1998 , vol. 92, # 2 p. 173 - 176 |
|
~%
triphenylcarben... CAS#:437-17-2 |
| Literature: Plack, Volker; Goerlich, Jens R.; Schmutzler, Reinhard Journal of Fluorine Chemistry, 1998 , vol. 92, # 2 p. 173 - 176 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| Triphenylcarbonium hexafluorophosphate |
| EINECS 207-112-0 |
| Triphenylcarbenium hexafluorophosphate |
| Trityl hexafluorophosphate |
| Triphenylmethyl hexafluorophosphate |
| Tritylium hexafluorophosphate |
| MFCD00013121 |
| Triphenylmethylcarbenium hexafluorophosphate |