robtin structure
|
Common Name | robtin | ||
|---|---|---|---|---|
| CAS Number | 4382-34-7 | Molecular Weight | 288.252 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 639.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3±25.0 °C | |
| Name | (2S)-7-Hydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydro-4H-chromen- 4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 639.2±55.0 °C at 760 mmHg |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.252 |
| Flash Point | 247.3±25.0 °C |
| Exact Mass | 288.063385 |
| PSA | 107.22000 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.725 |
| InChIKey | RZPNYDYGMFMXLQ-ZDUSSCGKSA-N |
| SMILES | O=C1CC(c2cc(O)c(O)c(O)c2)Oc2cc(O)ccc21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
|
~%
robtin CAS#:4382-34-7 |
| Literature: Pew Journal of the American Chemical Society, 1951 , vol. 73, p. 1678,1683,1685 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7,2'-dihydroxyflavanone |
| 3',4',5',7-tetrahydroxyflavanone |
| (2S)-7-Hydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-7-hydroxy-2-(3,4,5-trihydroxyphenyl)-, (2S)- |