4-chloro-6-(methoxymethyl)-2-(3-methylphenyl)pyrimidine structure
|
Common Name | 4-chloro-6-(methoxymethyl)-2-(3-methylphenyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 438249-83-3 | Molecular Weight | 248.70800 | |
| Density | 1.192g/cm3 | Boiling Point | 0ºC | |
| Molecular Formula | C13H13ClN2O | Melting Point | 0ºC | |
| MSDS | N/A | Flash Point | 0ºC | |
| Name | 4-chloro-6-(methoxymethyl)-2-(3-methylphenyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 0ºC |
| Melting Point | 0ºC |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.70800 |
| Flash Point | 0ºC |
| Exact Mass | 248.07200 |
| PSA | 35.01000 |
| LogP | 3.25180 |
| Index of Refraction | 1.566 |
| InChIKey | OWBBPBAWAUMHEO-UHFFFAOYSA-N |
| SMILES | COCc1cc(Cl)nc(-c2cccc(C)c2)n1 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-6-(methoxymethyl)-2-(m-tolyl)pyrimidine |