1-morpholin-4-yl-2-prop-2-enylbutane-1,3-dione structure
|
Common Name | 1-morpholin-4-yl-2-prop-2-enylbutane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 4383-70-4 | Molecular Weight | 211.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-morpholin-4-yl-2-prop-2-enylbutane-1,3-dione |
|---|
| Molecular Formula | C11H17NO3 |
|---|---|
| Molecular Weight | 211.25800 |
| Exact Mass | 211.12100 |
| PSA | 46.61000 |
| LogP | 0.56440 |
| InChIKey | ZLLQIXTUMPLUFS-UHFFFAOYSA-N |
| SMILES | C=CCC(C(C)=O)C(=O)N1CCOCC1 |
| HS Code | 2934999090 |
|---|
|
~86%
1-morpholin-4-y... CAS#:4383-70-4 |
| Literature: Stefani, Helio A.; Costa, Iguatemi M.; De O. Silva, Diogo; Menezes, Paulo H.; Rodrigues, Alessandro Phosphorus, Sulfur and Silicon and Related Elements, 2001 , vol. 171-172, p. 141 - 152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |