3-[(2,5-Dichlorophenoxy)methyl]benzoic acid structure
|
Common Name | 3-[(2,5-Dichlorophenoxy)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 438466-28-5 | Molecular Weight | 297.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(2,5-Dichlorophenoxy)methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10Cl2O3 |
|---|---|
| Molecular Weight | 297.13300 |
| Exact Mass | 296.00100 |
| PSA | 46.53000 |
| LogP | 4.27060 |
| InChIKey | CVZMWRUIYNDPCB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(COc2cc(Cl)ccc2Cl)c1 |
| HS Code | 2918990090 |
|---|
|
~88%
3-[(2,5-Dichlor... CAS#:438466-28-5 |
| Literature: Taniguchi, Takahiko; Miyata, Kenichi; Kubo, Osamu; Matsui, Junji Patent: US2009/325956 A1, 2009 ; Location in patent: Page/Page column 22 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 3-[(2,4-dichlorobenzyl)oxy]benzenecarboxylate |
| 3-[1-(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one |
| 3-(3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one |
| 3-[(2,4-dichlorophenyl)methoxy]-benzoic acid,methyl ester |
| 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one |