WAY-325463 structure
|
Common Name | WAY-325463 | ||
|---|---|---|---|---|
| CAS Number | 438474-02-3 | Molecular Weight | 353.45 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 531.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C22H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.2±25.9 °C | |
Use of WAY-32546311β-hydroxysteroid dehydrogenase type 1 modulator |
| Name | WAY-325463 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.4±35.0 °C at 760 mmHg |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.45 |
| Flash Point | 275.2±25.9 °C |
| Exact Mass | 353.199097 |
| LogP | 4.07 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | MFUXQBMFODKYNP-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(OCc2cccc(C(=O)N3CCCCCC3)c2)cc1 |
| Methanone, [3-[(4-ethoxyphenoxy)methyl]phenyl](hexahydro-1H-azepin-1-yl)- |
| 1-Azepanyl{3-[(4-ethoxyphenoxy)methyl]phenyl}methanone |