4'-Methoxy-2-p-methoxyphenylbutyrophenone structure
|
Common Name | 4'-Methoxy-2-p-methoxyphenylbutyrophenone | ||
|---|---|---|---|---|
| CAS Number | 4390-94-7 | Molecular Weight | 284.35000 | |
| Density | 1.079 g/cm3 | Boiling Point | 428.1ºC at 760 mmHg | |
| Molecular Formula | C18H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.5ºC | |
| Name | 1,2-bis(4-methoxyphenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.079 g/cm3 |
|---|---|
| Boiling Point | 428.1ºC at 760 mmHg |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35000 |
| Flash Point | 204.5ºC |
| Exact Mass | 284.14100 |
| PSA | 35.53000 |
| LogP | 4.08030 |
| Index of Refraction | 1.545 |
| InChIKey | PBHOMCCEZCLALM-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2-bis(4-methoxyphenyl)-1-butanone |
| p-methoxy-2-(p-methoxyphenyl)-butyrophenone |
| di-(methoxy-4'-phenyl)-1,2 butanone-1 |
| d,l-1,2-bis(4-methoxyphenyl)-1-butanone |
| 4'-METHOXY-2-P-METHOXYPHENYLBUTYROPHENONE |
| 1,2-bis(4-methoxyphenyl)butanone |