1-Isothiocyanatoadamantane structure
|
Common Name | 1-Isothiocyanatoadamantane | ||
|---|---|---|---|---|
| CAS Number | 4411-26-1 | Molecular Weight | 193.309 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 297.6±7.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NS | Melting Point | 166-168 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 138.0±26.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-adamantyl isothiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.6±7.0 °C at 760 mmHg |
| Melting Point | 166-168 °C(lit.) |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.309 |
| Flash Point | 138.0±26.0 °C |
| Exact Mass | 193.092514 |
| PSA | 44.45000 |
| LogP | 3.82 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | YPKFLUARLJRPQM-UHFFFAOYSA-N |
| SMILES | S=C=NC12CC3CC(CC(C3)C1)C2 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2930909090 |
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
7-Methoxytacrine-adamantylamine heterodimers as cholinesterase inhibitors in Alzheimer's disease treatment--synthesis, biological evaluation and molecular modeling studies.
Molecules 18(2) , 2397-418, (2013) A structural series of 7-MEOTA-adamantylamine thioureas was designed, synthesized and evaluated as inhibitors of human acetylcholinesterase (hAChE) and human butyrylcholinesterase (hBChE). The compoun... |
|
|
Synthesis and structural characterization of tris(2-mercapto-1-adamantylimidazolyl)hydroborato complexes: a sterically demanding tripodal [S3] donor ligand.
Inorg. Chem. , (2011) The tris(2-mercapto-1-adamantylimidazolyl)hydroborato ligand, [Tm(Ad)], has been synthesized via the reaction of 1-adamantyl-2-mercaptoimidazole with MBH(4) (M = Li, K). [Tm(Ad)]M has been used to syn... |
|
|
[Antiviral agents / 9th communication: virustatically active N-(1-adamantyl)-thiourea derivatives based on cyclic secondary amines (author's transl)].
Arzneimittelforschung 27(5) , 969-72, (1977) By nucleophilic addition of pyrrolidine (2a), piperidine (2b), 3-hydroxypiperidine (2c), and 4-hydroxypiperidine (2d) on 1-adamantyl-isothiocyanate (1), the N',N'-disubstituted N-(1-adamantyl)-thioure... |
| 1-Adamantyl Isothiocyanate |
| (3s,5s,7s)-1-Isothiocyanatoadamantane |
| 1-Isothiocyanatoadamantane |
| Isothiocyanic Acid 1-Adamantyl Ester |
| Tricyclo[3.3.1.1]decane, 1-isothiocyanato- |
| MFCD00074736 |
| Tricyclo(3.3.1.1(3,7))decane, 1-isothiocyanato- |
| EINECS 224-564-4 |