testololactone structure
|
Common Name | testololactone | ||
|---|---|---|---|---|
| CAS Number | 4416-57-3 | Molecular Weight | 302.40800 | |
| Density | 1.15g/cm3 | Boiling Point | 478.2ºC at 760mmHg | |
| Molecular Formula | C19H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
Use of testololactoneTestololactone is an aromatase inhibitor. Testololactone can be used for research of breast carcinoma[1]. |
| Name | testololactone |
|---|---|
| Synonym | More Synonyms |
| Description | Testololactone is an aromatase inhibitor. Testololactone can be used for research of breast carcinoma[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 478.2ºC at 760mmHg |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.40800 |
| Flash Point | 211.2ºC |
| Exact Mass | 302.18800 |
| PSA | 43.37000 |
| LogP | 3.81390 |
| Index of Refraction | 1.549 |
| InChIKey | CNIXJDVUMXTEKX-DZBHQSCQSA-N |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43C)C1CCC(=O)O2 |
| 17a-Oxa-D-homoandrost-4-ene-3,17-dione |
| 17a-oxa-D-homo-4-androsten-3,17-dione |
| D-Homo-17a-oxaandrost-4-ene-3,17-dione |
| 17A-oxa-D-homo-androst-4-en-3,17-dion |
| 17a-Oxa-D-homoandrosta-4-ene-3,17-dione |
| 17a-oxa-D-homo-androst-4-ene-3,17-dione |