Testolactone structure
|
Common Name | Testolactone | ||
|---|---|---|---|---|
| CAS Number | 968-93-4 | Molecular Weight | 300.392 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 482.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H24O3 | Melting Point | 218-219ºC | |
| MSDS | N/A | Flash Point | 213.4±28.8 °C | |
| Name | testolactone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 482.0±45.0 °C at 760 mmHg |
| Melting Point | 218-219ºC |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.392 |
| Flash Point | 213.4±28.8 °C |
| Exact Mass | 300.172546 |
| PSA | 43.37000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | BPEWUONYVDABNZ-DZBHQSCQSA-N |
| SMILES | CC12CCC3C(CCC4=CC(=O)C=CC43C)C1CCC(=O)O2 |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
|
Name: Compound was evaluated for inhibition of rat Gabra1 in an in vitro assay with cellula...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-1
External Id: CHEMBL5291801
|
|
Name: Binding affinity towards rat Gabra1 in an in vitro assay with cellular components mea...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-1
External Id: CHEMBL5291798
|
|
Name: Binding affinity towards human ESR1 in an in vitro cell free assay (NIBR assay) measu...
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL5291791
|
|
Name: Human CYP19A1 (CYP11, CYP17, CYP19, CYP20 and CYP21 families)
Source: IUPHAR-DB
Target: CYP19A1 (CYP11, CYP17, CYP19, CYP20 and CYP21 families) [Homo sapiens]
External Id: 1362_Human
|
|
Name: Binding affinity towards human DRD2 in an in vitro assay with cellular components mea...
Source: ChEMBL
Target: D(2) dopamine receptor
External Id: CHEMBL5291781
|
|
Name: A screen for small molecules that modulate mitochondrial supercomplex formation
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: N/A
External Id: HMS1482
|
|
Name: Agonist activity at human DRD1 in an in vitro cell-based assay measured by time-resol...
Source: ChEMBL
Target: D(1A) dopamine receptor
External Id: CHEMBL5291777
|
|
Name: Antagonist activity at human CNR1 in an in vitro cell-based assay measured by fluores...
Source: ChEMBL
Target: Cannabinoid receptor 1
External Id: CHEMBL5291772
|
|
Name: Agonist activity at human CNR1 in an in vitro cell-based assay measured by fluorescen...
Source: ChEMBL
Target: Cannabinoid receptor 1
External Id: CHEMBL5291771
|
|
Name: Binding affinity towards human CNR1 in an in vitro assay with cellular components mea...
Source: ChEMBL
Target: Cannabinoid receptor 1
External Id: CHEMBL5291773
|
| teslak |
| D1-testololactone |
| TESLAC |
| δ1-Testololactone |
| testolacton |
| 17a-Oxo-D-homo-1,4-androstadiene-3,17-dione |
| testololactone |
| 1,2,3,4,4a,4b,7,9,10,10a-Decahydro-2-hydroxy-2,4b-dimethyl-7-oxo-1-phenanthrenepropionic Acid d-Lactone |
| EINECS 213-534-6 |
| teolit |
| sq9538 |
| MFCD00866295 |
| Testolactone |
| 17a-oxa-D-homo-1,4-androstadien-3,17-dione |
| fludestrin |
| 13-Hydroxy-3-oxo-13,17-secoandrosta-1,4-dien-17-oic Acid d-Lactone |
| (4aS,4bR,10aR,10bS,12aS)-10a,12a-Dimethyl-3,4,4a,5,6,10a,10b,11,12,12a-decahydro-2H-naphtho[2,1-f]chromene-2,8(4bH)-dione |