6-(2-chlorophenyl)-2,2-dimethylpiperidin-4-one structure
|
Common Name | 6-(2-chlorophenyl)-2,2-dimethylpiperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 4423-96-5 | Molecular Weight | 237.72500 | |
| Density | 1.113g/cm3 | Boiling Point | 330.2ºC at 760 mmHg | |
| Molecular Formula | C13H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.5ºC | |
| Name | 6-(2-chlorophenyl)-2,2-dimethylpiperidin-4-one |
|---|
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 330.2ºC at 760 mmHg |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.72500 |
| Flash Point | 153.5ºC |
| Exact Mass | 237.09200 |
| PSA | 29.10000 |
| LogP | 3.44100 |
| Index of Refraction | 1.522 |
| InChIKey | CSCYTRMTQDBUGL-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CC(c2ccccc2Cl)N1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |