Azophenine
Azophenine structure
|
Common Name | Azophenine | ||
|---|---|---|---|---|
| CAS Number | 4435-12-5 | Molecular Weight | 440.53800 | |
| Density | 1.12g/cm3 | Boiling Point | 564ºC at 760 mmHg | |
| Molecular Formula | C30H24N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 564ºC at 760 mmHg |
| Molecular Formula | C30H24N4 |
| Molecular Weight | 440.53800 |
| Flash Point | 294.9ºC |
| Exact Mass | 440.20000 |
| PSA | 48.78000 |
| LogP | 7.68340 |
| Index of Refraction | 1.635 |
| InChIKey | IDDYUZBZSSUAGK-UHFFFAOYSA-N |
| SMILES | C1=C(Nc2ccccc2)C(=Nc2ccccc2)C=C(Nc2ccccc2)C1=Nc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:106-50-3
CAS#:3421-08-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-Dianilino-[1,4]benzochinon-bis-phenylimin |
| 2.5-Dianilino-benzochinon-(1.4)-dianil |
| 2,5-dianilino-[1,4]benzoquinone-bis-phenylimine |
| 2.5-Dianilino-p-chinon-dianil |
| [2,5-bis(phenylazamethylene)-4-(phenylamino)cyclohexa-1(6),3-dienyl]phenylamin e |
| N,N',N'',N'''-tetraphenyl-2,5-diamino-1,4-diiminobenzoquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: Boiling point of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine is 564ºC at 760 mmHg. |
| Q: What English synonyms does 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine have? |
| A: English synonyms of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine: 2,5-Dianilino-[1,4]benzochinon-bis-phenylimin, 2.5-Dianilino-benzochinon-(1.4)-dianil, 2,5-dianilino-[1,4]benzoquinone-bis-phenylimine, 2.5-Dianilino-p-chinon-dianil, [2,5-bis(phenylazamethylene)-4-(phenylamino)cyclohexa-1(6),3-dienyl]phenylamin e, N,N',N'',N'''-tetraphenyl-2,5-diamino-1,4-diiminobenzoquinone. |
| Q: What is the InChIKey of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: InChIKey of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine is IDDYUZBZSSUAGK-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: LogP of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine is 7.68340. |
| Q: What is the CAS number of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: CAS number of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine is 4435-12-5. |
| Q: What are the downstream products of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: Related downstream products(CAS) of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine: 106-50-3;3421-08-7. |
| Q: What is the polar surface area (PSA) of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: Polar surface area (PSA) of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine is 48.78000. |
| Q: What is the Chinese name of 4435-12-5? |
| A: Chinese name of 4435-12-5 is 4435-12-5. |
| Q: What is the SMILES notation of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: SMILES notation of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine is C1=C(Nc2ccccc2)C(=Nc2ccccc2)C=C(Nc2ccccc2)C1=Nc1ccccc1. |
| Q: What is the English name of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine? |
| A: The English name of 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine is 1-N,4-N-diphenyl-3,6-bis(phenylimino)cyclohexa-1,4-diene-1,4-diamine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |