p-Benzoquinone, 2,5-dianilino- structure
|
Common Name | p-Benzoquinone, 2,5-dianilino- | ||
|---|---|---|---|---|
| CAS Number | 3421-08-7 | Molecular Weight | 290.31600 | |
| Density | 1.37g/cm3 | Boiling Point | 471.9ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 2,5-dianilinocyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 471.9ºC at 760 mmHg |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.31600 |
| Flash Point | 175.8ºC |
| Exact Mass | 290.10600 |
| PSA | 58.20000 |
| LogP | 3.27620 |
| Index of Refraction | 1.741 |
| InChIKey | GETDOINCEIMJDH-UHFFFAOYSA-N |
| SMILES | O=C1C=C(Nc2ccccc2)C(=O)C=C1Nc1ccccc1 |
| HS Code | 2922399090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| p-Benzoquinone,5-dianilino |
| 2,5-dianilino-p-benzoquinone |
| 2,5-dianilinobenzo-1,4-quinone |
| 2,5-diamino-p-benzoquinone |
| Helindon Yellow CA |
| 2,5-dianilino-1,4-benzoquinone |
| Helindon Yellow CAK |