S119-8 structure
|
Common Name | S119-8 | ||
|---|---|---|---|---|
| CAS Number | 443639-96-1 | Molecular Weight | 344.449 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 447.3±38.0 °C at 760 mmHg | |
| Molecular Formula | C23H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.3±26.9 °C | |
Use of S119-8S119-8 is a broad spectrum inhibitor of influenza A and B viruses. |
| Name | S119-8 |
|---|---|
| Synonym | More Synonyms |
| Description | S119-8 is a broad spectrum inhibitor of influenza A and B viruses. |
|---|---|
| Related Catalog | |
| Target |
Influenza A and B[1] |
| In Vitro | S119-8 is an analog of S119. S119-8 has acquired enhanced broad-spectrum activity with improved calculated physical properties, while maintaining significant potency (IC50=1.43 μM) at non-toxic (CC50=66.10 μM) concentrations, albeit somewhat higher (7-fold) than that of the parent S119 against influenza A/WSN/33 H1N1 (WSN) virus. S119-8 also shows activity against multiple influenza B viruses and an oseltamivir-resistant influenza A virus, but does not inhibit a non-influenza virus, vesicular stomatitis nirus (VSV). S119-8 has increased breadth of inhibition against influenza A and B viruses accompanied by only a small loss in potency. S119-8 inhibits influenza viruses A/Puerto Rico/8/1934 (H1N1) (PR8) with an IC50 of 6.05 μM. S119-8 inhibits influenza A/Vietnam/1203/2004 (H5N1) with an IC50 of 8.42 μM[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.3±38.0 °C at 760 mmHg |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.449 |
| Flash Point | 128.3±26.9 °C |
| Exact Mass | 344.188873 |
| LogP | 4.66 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | NEPKMQDGCTXOPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(Nc3ccccc3)cc2)cc1 |
| Storage condition | 2-8℃ |
| N-(4-anilinophenyl)-4-tert-butylbenzamide |
| Benzamide, 4-(1,1-dimethylethyl)-N-[4-(phenylamino)phenyl]- |
| MFCD01121291 |
| N-(4-Anilinophenyl)-4-(2-methyl-2-propanyl)benzamide |